C8H13N3O2 — CID 62928561
1-(2-aminopropyl)-4-methylpyrazine-2,3-dione (PubChem CID 62928561) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 1-(2-aminopropyl)-4-methylpyrazine-2,3-dione.
| Compound Name | 1-(2-aminopropyl)-4-methylpyrazine-2,3-dione |
|---|---|
| PubChem CID | 62928561 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 1-(2-aminopropyl)-4-methylpyrazine-2,3-dione |
| SMILES | CC(N)Cn1ccn(C)c(=O)c1=O |
| InChI | InChI=1S/C8H13N3O2/c1-6(9)5-11-4-3-10(2)7(12)8(11)13/h3-4,6H,5,9H2,1-2H3 |
| InChIKey | HZAAUQAVKDGAKH-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|