C11H15N3O5 — CID 65444218
methyl 2-acetamido-3-(4-methyl-2,3-dioxopyrazin-1-yl)propanoate (PubChem CID 65444218) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is methyl 2-acetamido-3-(4-methyl-2,3-dioxopyrazin-1-yl)propanoate.
| Compound Name | methyl 2-acetamido-3-(4-methyl-2,3-dioxopyrazin-1-yl)propanoate |
|---|---|
| PubChem CID | 65444218 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | methyl 2-acetamido-3-(4-methyl-2,3-dioxopyrazin-1-yl)propanoate |
| SMILES | COC(=O)C(Cn1ccn(C)c(=O)c1=O)NC(C)=O |
| InChI | InChI=1S/C11H15N3O5/c1-7(15)12-8(11(18)19-3)6-14-5-4-13(2)9(16)10(14)17/h4-5,8H,6H2,1-3H3,(H,12,15) |
| InChIKey | RTBFXANVHCHDLP-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|