C15H26N4O — CID 104747622
2-[2-cyclopentyl-2-(ethylamino)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 104747622) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[2-cyclopentyl-2-(ethylamino)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[2-cyclopentyl-2-(ethylamino)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 104747622 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-[2-cyclopentyl-2-(ethylamino)ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CCNC(Cn1nc2n(c1=O)CCCC2)C1CCCC1 |
| InChI | InChI=1S/C15H26N4O/c1-2-16-13(12-7-3-4-8-12)11-19-15(20)18-10-6-5-9-14(18)17-19/h12-13,16H,2-11H2,1H3 |
| InChIKey | SPINRTBHYQHOQJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |