C13H17F3N2O2 — CID 104747694
1-[2-(methylamino)-2-(oxolan-3-yl)ethyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 104747694) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-[2-(methylamino)-2-(oxolan-3-yl)ethyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-(methylamino)-2-(oxolan-3-yl)ethyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 104747694 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-[2-(methylamino)-2-(oxolan-3-yl)ethyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CNC(Cn1cc(C(F)(F)F)ccc1=O)C1CCOC1 |
| InChI | InChI=1S/C13H17F3N2O2/c1-17-11(9-4-5-20-8-9)7-18-6-10(13(14,15)16)2-3-12(18)19/h2-3,6,9,11,17H,4-5,7-8H2,1H3 |
| InChIKey | CGBVFRJVYUZGKK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |