C12H15F3N2O2 — CID 104747699
1-[2-amino-2-(oxolan-3-yl)ethyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 104747699) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 1-[2-amino-2-(oxolan-3-yl)ethyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-amino-2-(oxolan-3-yl)ethyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 104747699 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-[2-amino-2-(oxolan-3-yl)ethyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | NC(Cn1cc(C(F)(F)F)ccc1=O)C1CCOC1 |
| InChI | InChI=1S/C12H15F3N2O2/c13-12(14,15)9-1-2-11(18)17(5-9)6-10(16)8-3-4-19-7-8/h1-2,5,8,10H,3-4,6-7,16H2 |
| InChIKey | YQSPBRRJFOHIII-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |