C12H16N4O2 — CID 104748230
5-[2-amino-2-(oxolan-3-yl)ethyl]pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 104748230) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 5-[2-amino-2-(oxolan-3-yl)ethyl]pyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 5-[2-amino-2-(oxolan-3-yl)ethyl]pyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 104748230 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 5-[2-amino-2-(oxolan-3-yl)ethyl]pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | NC(Cn1ccn2nccc2c1=O)C1CCOC1 |
| InChI | InChI=1S/C12H16N4O2/c13-10(9-2-6-18-8-9)7-15-4-5-16-11(12(15)17)1-3-14-16/h1,3-5,9-10H,2,6-8,13H2 |
| InChIKey | VWVFIIQNRMOXFU-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |