C13H23NOS — CID 104750832
1-cyclopentyl-2-(2,6-dimethylthiomorpholin-4-yl)ethanone (PubChem CID 104750832) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is 1-cyclopentyl-2-(2,6-dimethylthiomorpholin-4-yl)ethanone.
| Compound Name | 1-cyclopentyl-2-(2,6-dimethylthiomorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 104750832 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 1-cyclopentyl-2-(2,6-dimethylthiomorpholin-4-yl)ethanone |
| SMILES | CC1CN(CC(=O)C2CCCC2)CC(C)S1 |
| InChI | InChI=1S/C13H23NOS/c1-10-7-14(8-11(2)16-10)9-13(15)12-5-3-4-6-12/h10-12H,3-9H2,1-2H3 |
| InChIKey | MYIUAYCNEGGXKA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |