C11H20F3NO — CID 104752579
1-cyclohexyl-2-[methyl(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 104752579) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 1-cyclohexyl-2-[methyl(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 1-cyclohexyl-2-[methyl(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 104752579 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-cyclohexyl-2-[methyl(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | CN(CC(O)C1CCCCC1)CC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c1-15(8-11(12,13)14)7-10(16)9-5-3-2-4-6-9/h9-10,16H,2-8H2,1H3 |
| InChIKey | ZUAQNLGPBRXERX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |