C11H18N2O2 — CID 104753209
2-(4,5-dimethylimidazol-1-yl)-1-(oxolan-3-yl)ethanol (PubChem CID 104753209) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(4,5-dimethylimidazol-1-yl)-1-(oxolan-3-yl)ethanol.
| Compound Name | 2-(4,5-dimethylimidazol-1-yl)-1-(oxolan-3-yl)ethanol |
|---|---|
| PubChem CID | 104753209 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-(4,5-dimethylimidazol-1-yl)-1-(oxolan-3-yl)ethanol |
| SMILES | Cc1ncn(CC(O)C2CCOC2)c1C |
| InChI | InChI=1S/C11H18N2O2/c1-8-9(2)13(7-12-8)5-11(14)10-3-4-15-6-10/h7,10-11,14H,3-6H2,1-2H3 |
| InChIKey | CRQMYKGICFSIDI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |