C14H21ClN2OS — CID 104755832
N-[2-[(5-chloro-2-pyridinyl)sulfanyl]-1-(oxolan-3-yl)ethyl]propan-1-amine (PubChem CID 104755832) has the molecular formula C14H21ClN2OS and a molecular weight of 300.85 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)sulfanyl]-1-(oxolan-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)sulfanyl]-1-(oxolan-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 104755832 |
| Molecular Formula | C14H21ClN2OS |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)sulfanyl]-1-(oxolan-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(CSc1ccc(Cl)cn1)C1CCOC1 |
| InChI | InChI=1S/C14H21ClN2OS/c1-2-6-16-13(11-5-7-18-9-11)10-19-14-4-3-12(15)8-17-14/h3-4,8,11,13,16H,2,5-7,9-10H2,1H3 |
| InChIKey | OYMIAWFVCWUXGJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |