C16H25ClN2S — CID 104755834
N-[2-[(5-chloro-2-pyridinyl)sulfanyl]-1-cyclohexylethyl]propan-1-amine (PubChem CID 104755834) has the molecular formula C16H25ClN2S and a molecular weight of 312.91 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)sulfanyl]-1-cyclohexylethyl]propan-1-amine.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)sulfanyl]-1-cyclohexylethyl]propan-1-amine |
|---|---|
| PubChem CID | 104755834 |
| Molecular Formula | C16H25ClN2S |
| Molecular Weight | 312.91 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)sulfanyl]-1-cyclohexylethyl]propan-1-amine |
| SMILES | CCCNC(CSc1ccc(Cl)cn1)C1CCCCC1 |
| InChI | InChI=1S/C16H25ClN2S/c1-2-10-18-15(13-6-4-3-5-7-13)12-20-16-9-8-14(17)11-19-16/h8-9,11,13,15,18H,2-7,10,12H2,1H3 |
| InChIKey | JFKSILRQJQYSQX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |