C14H16Cl2O2S — CID 104756236
1-cyclohexyl-2-(2,5-dichlorophenyl)sulfinylethanone (PubChem CID 104756236) has the molecular formula C14H16Cl2O2S and a molecular weight of 319.25 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2,5-dichlorophenyl)sulfinylethanone.
| Compound Name | 1-cyclohexyl-2-(2,5-dichlorophenyl)sulfinylethanone |
|---|---|
| PubChem CID | 104756236 |
| Molecular Formula | C14H16Cl2O2S |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 1-cyclohexyl-2-(2,5-dichlorophenyl)sulfinylethanone |
| SMILES | O=C(CS(=O)c1cc(Cl)ccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C14H16Cl2O2S/c15-11-6-7-12(16)14(8-11)19(18)9-13(17)10-4-2-1-3-5-10/h6-8,10H,1-5,9H2 |
| InChIKey | CKDAXEPUFGXKHP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |