C16H14Cl2O2S — CID 64635380
2-(2,5-dichlorophenyl)sulfinyl-1-(4-ethylphenyl)ethanone (PubChem CID 64635380) has the molecular formula C16H14Cl2O2S and a molecular weight of 341.26 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfinyl-1-(4-ethylphenyl)ethanone.
| Compound Name | 2-(2,5-dichlorophenyl)sulfinyl-1-(4-ethylphenyl)ethanone |
|---|---|
| PubChem CID | 64635380 |
| Molecular Formula | C16H14Cl2O2S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfinyl-1-(4-ethylphenyl)ethanone |
| SMILES | CCc1ccc(C(=O)CS(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C16H14Cl2O2S/c1-2-11-3-5-12(6-4-11)15(19)10-21(20)16-9-13(17)7-8-14(16)18/h3-9H,2,10H2,1H3 |
| InChIKey | QTCSMRWZHDJOAJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |