C16H22O3S — CID 104756338
1-cyclopentyl-2-[(3,5-dimethylphenyl)methylsulfonyl]ethanone (PubChem CID 104756338) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-cyclopentyl-2-[(3,5-dimethylphenyl)methylsulfonyl]ethanone.
| Compound Name | 1-cyclopentyl-2-[(3,5-dimethylphenyl)methylsulfonyl]ethanone |
|---|---|
| PubChem CID | 104756338 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1-cyclopentyl-2-[(3,5-dimethylphenyl)methylsulfonyl]ethanone |
| SMILES | Cc1cc(C)cc(CS(=O)(=O)CC(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C16H22O3S/c1-12-7-13(2)9-14(8-12)10-20(18,19)11-16(17)15-5-3-4-6-15/h7-9,15H,3-6,10-11H2,1-2H3 |
| InChIKey | ONUOSXQJQCEMMD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |