C15H20O3S — CID 104756083
2-benzylsulfonyl-1-cyclohexylethanone (PubChem CID 104756083) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-benzylsulfonyl-1-cyclohexylethanone.
| Compound Name | 2-benzylsulfonyl-1-cyclohexylethanone |
|---|---|
| PubChem CID | 104756083 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-benzylsulfonyl-1-cyclohexylethanone |
| SMILES | O=C(CS(=O)(=O)Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C15H20O3S/c16-15(14-9-5-2-6-10-14)12-19(17,18)11-13-7-3-1-4-8-13/h1,3-4,7-8,14H,2,5-6,9-12H2 |
| InChIKey | BHUSBAMAMNXOMT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |