C11H14O3S2 — CID 104756093
1-cyclopentyl-2-thiophen-2-ylsulfonylethanone (PubChem CID 104756093) has the molecular formula C11H14O3S2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-cyclopentyl-2-thiophen-2-ylsulfonylethanone.
| Compound Name | 1-cyclopentyl-2-thiophen-2-ylsulfonylethanone |
|---|---|
| PubChem CID | 104756093 |
| Molecular Formula | C11H14O3S2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 1-cyclopentyl-2-thiophen-2-ylsulfonylethanone |
| SMILES | O=C(CS(=O)(=O)c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C11H14O3S2/c12-10(9-4-1-2-5-9)8-16(13,14)11-6-3-7-15-11/h3,6-7,9H,1-2,4-5,8H2 |
| InChIKey | ONIHYQUIOWPFLW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |