C14H13NO3S2 — CID 166512178
1-(1,3-dihydroisoindol-2-yl)-2-thiophen-2-ylsulfonylethanone (PubChem CID 166512178) has the molecular formula C14H13NO3S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-(1,3-dihydroisoindol-2-yl)-2-thiophen-2-ylsulfonylethanone.
| Compound Name | 1-(1,3-dihydroisoindol-2-yl)-2-thiophen-2-ylsulfonylethanone |
|---|---|
| PubChem CID | 166512178 |
| Molecular Formula | C14H13NO3S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 1-(1,3-dihydroisoindol-2-yl)-2-thiophen-2-ylsulfonylethanone |
| SMILES | O=C(CS(=O)(=O)c1cccs1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H13NO3S2/c16-13(10-20(17,18)14-6-3-7-19-14)15-8-11-4-1-2-5-12(11)9-15/h1-7H,8-10H2 |
| InChIKey | AVXYHZSEMQHEDE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |