C16H14FNO3S — CID 166512201
1-(1,3-dihydroisoindol-2-yl)-2-(2-fluorophenyl)sulfonylethanone (PubChem CID 166512201) has the molecular formula C16H14FNO3S and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-(1,3-dihydroisoindol-2-yl)-2-(2-fluorophenyl)sulfonylethanone.
| Compound Name | 1-(1,3-dihydroisoindol-2-yl)-2-(2-fluorophenyl)sulfonylethanone |
|---|---|
| PubChem CID | 166512201 |
| Molecular Formula | C16H14FNO3S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 1-(1,3-dihydroisoindol-2-yl)-2-(2-fluorophenyl)sulfonylethanone |
| SMILES | O=C(CS(=O)(=O)c1ccccc1F)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H14FNO3S/c17-14-7-3-4-8-15(14)22(20,21)11-16(19)18-9-12-5-1-2-6-13(12)10-18/h1-8H,9-11H2 |
| InChIKey | FGKUAJSEQLWDMX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |