C13H13F2NO4S — CID 64642010
1-[2-(2,4-difluorophenyl)sulfonylacetyl]piperidin-4-one (PubChem CID 64642010) has the molecular formula C13H13F2NO4S and a molecular weight of 317.31 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenyl)sulfonylacetyl]piperidin-4-one.
| Compound Name | 1-[2-(2,4-difluorophenyl)sulfonylacetyl]piperidin-4-one |
|---|---|
| PubChem CID | 64642010 |
| Molecular Formula | C13H13F2NO4S |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-[2-(2,4-difluorophenyl)sulfonylacetyl]piperidin-4-one |
| SMILES | O=C1CCN(C(=O)CS(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C13H13F2NO4S/c14-9-1-2-12(11(15)7-9)21(19,20)8-13(18)16-5-3-10(17)4-6-16/h1-2,7H,3-6,8H2 |
| InChIKey | TVWJPPWXILGVLX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |