C13H13Cl2NO4S — CID 64635390
1-[2-(2,6-dichlorophenyl)sulfonylacetyl]piperidin-4-one (PubChem CID 64635390) has the molecular formula C13H13Cl2NO4S and a molecular weight of 350.22 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenyl)sulfonylacetyl]piperidin-4-one.
| Compound Name | 1-[2-(2,6-dichlorophenyl)sulfonylacetyl]piperidin-4-one |
|---|---|
| PubChem CID | 64635390 |
| Molecular Formula | C13H13Cl2NO4S |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 1-[2-(2,6-dichlorophenyl)sulfonylacetyl]piperidin-4-one |
| SMILES | O=C1CCN(C(=O)CS(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C13H13Cl2NO4S/c14-10-2-1-3-11(15)13(10)21(19,20)8-12(18)16-6-4-9(17)5-7-16/h1-3H,4-8H2 |
| InChIKey | VKSLPFLDYCRYHJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |