C14H9BrCl2O3S — CID 64635956
1-(2-bromophenyl)-2-(2,6-dichlorophenyl)sulfonylethanone (PubChem CID 64635956) has the molecular formula C14H9BrCl2O3S and a molecular weight of 408.10 g/mol. Its IUPAC name is 1-(2-bromophenyl)-2-(2,6-dichlorophenyl)sulfonylethanone.
| Compound Name | 1-(2-bromophenyl)-2-(2,6-dichlorophenyl)sulfonylethanone |
|---|---|
| PubChem CID | 64635956 |
| Molecular Formula | C14H9BrCl2O3S |
| Molecular Weight | 408.10 g/mol |
| Exact Mass | 405.88 |
| IUPAC Name | 1-(2-bromophenyl)-2-(2,6-dichlorophenyl)sulfonylethanone |
| SMILES | O=C(CS(=O)(=O)c1c(Cl)cccc1Cl)c1ccccc1Br |
| InChI | InChI=1S/C14H9BrCl2O3S/c15-10-5-2-1-4-9(10)13(18)8-21(19,20)14-11(16)6-3-7-12(14)17/h1-7H,8H2 |
| InChIKey | CVBCXGZSFUXJKQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.10 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |