C25H30O4 — CID 10475740
[(1S,2S,10S,13R,14S,17R,18S)-17-ethynyl-6-formyl-2,18-dimethyl-7-oxapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5-dien-17-yl] formate (PubChem CID 10475740) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is [(1S,2S,10S,13R,14S,17R,18S)-17-ethynyl-6-formyl-2,18-dimethyl-7-oxapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5-dien-17-yl] formate.
| Compound Name | [(1S,2S,10S,13R,14S,17R,18S)-17-ethynyl-6-formyl-2,18-dimethyl-7-oxapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5-dien-17-yl] formate |
|---|---|
| PubChem CID | 10475740 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [(1S,2S,10S,13R,14S,17R,18S)-17-ethynyl-6-formyl-2,18-dimethyl-7-oxapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5-dien-17-yl] formate |
| SMILES | C#C[C@]1(OC=O)CC[C@H]2[C@@H]3CC[C@H]4Cc5oc(C=O)cc5C[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C25H30O4/c1-4-25(28-15-27)10-8-21-19-6-5-17-12-22-16(11-18(14-26)29-22)13-23(17,2)20(19)7-9-24(21,25)3/h1,11,14-15,17,19-21H,5-10,12-13H2,2-3H3/t17-,19+,20-,21-,23-,24-,25-/m0/s1 |
| InChIKey | QBJZXFGDUJUSBD-BDOHWBQPSA-N |
| XLogP | 4.59 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|