C25H36O4 — CID 88956175
[(3R,5S,10S,13S,17R)-17-ethynyl-10,13-dimethyl-3-(2-oxoethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 88956175) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is [(3R,5S,10S,13S,17R)-17-ethynyl-10,13-dimethyl-3-(2-oxoethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3R,5S,10S,13S,17R)-17-ethynyl-10,13-dimethyl-3-(2-oxoethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 88956175 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [(3R,5S,10S,13S,17R)-17-ethynyl-10,13-dimethyl-3-(2-oxoethoxy)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | C#C[C@]1(OC(C)=O)CCC2C3CC[C@H]4C[C@H](OCC=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C25H36O4/c1-5-25(29-17(2)27)13-10-22-20-7-6-18-16-19(28-15-14-26)8-11-23(18,3)21(20)9-12-24(22,25)4/h1,14,18-22H,6-13,15-16H2,2-4H3/t18-,19+,20?,21?,22?,23-,24-,25-/m0/s1 |
| InChIKey | BDZZWBKYCKXKEA-CLFLZWIPSA-N |
| XLogP | 4.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|