C23H34O3 — CID 88956176
2-[[(3R,5S,10S,13S,17R)-17-ethynyl-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]acetaldehyde (PubChem CID 88956176) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 2-[[(3R,5S,10S,13S,17R)-17-ethynyl-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]acetaldehyde.
| Compound Name | 2-[[(3R,5S,10S,13S,17R)-17-ethynyl-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]acetaldehyde |
|---|---|
| PubChem CID | 88956176 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2-[[(3R,5S,10S,13S,17R)-17-ethynyl-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]acetaldehyde |
| SMILES | C#C[C@]1(O)CCC2C3CC[C@H]4C[C@H](OCC=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C23H34O3/c1-4-23(25)12-9-20-18-6-5-16-15-17(26-14-13-24)7-10-21(16,2)19(18)8-11-22(20,23)3/h1,13,16-20,25H,5-12,14-15H2,2-3H3/t16-,17+,18?,19?,20?,21-,22-,23-/m0/s1 |
| InChIKey | SIBCIGANHRQCGR-YBQSFBLHSA-N |
| XLogP | 3.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|