C13H13IN2O3 — CID 104757417
N-[(5-iodofuran-2-yl)methyl]-2,4-dimethyl-5-nitroaniline (PubChem CID 104757417) has the molecular formula C13H13IN2O3 and a molecular weight of 372.16 g/mol. Its IUPAC name is N-[(5-iodofuran-2-yl)methyl]-2,4-dimethyl-5-nitroaniline.
| Compound Name | N-[(5-iodofuran-2-yl)methyl]-2,4-dimethyl-5-nitroaniline |
|---|---|
| PubChem CID | 104757417 |
| Molecular Formula | C13H13IN2O3 |
| Molecular Weight | 372.16 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | N-[(5-iodofuran-2-yl)methyl]-2,4-dimethyl-5-nitroaniline |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1NCc1ccc(I)o1 |
| InChI | InChI=1S/C13H13IN2O3/c1-8-5-9(2)12(16(17)18)6-11(8)15-7-10-3-4-13(14)19-10/h3-6,15H,7H2,1-2H3 |
| InChIKey | FZBXIYVFDVAWTC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 68.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.16 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|