C12H13N3O3 — CID 113449722
2,4-dimethyl-5-nitro-N-(1,3-oxazol-5-ylmethyl)aniline (PubChem CID 113449722) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2,4-dimethyl-5-nitro-N-(1,3-oxazol-5-ylmethyl)aniline.
| Compound Name | 2,4-dimethyl-5-nitro-N-(1,3-oxazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 113449722 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2,4-dimethyl-5-nitro-N-(1,3-oxazol-5-ylmethyl)aniline |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1NCc1cnco1 |
| InChI | InChI=1S/C12H13N3O3/c1-8-3-9(2)12(15(16)17)4-11(8)14-6-10-5-13-7-18-10/h3-5,7,14H,6H2,1-2H3 |
| InChIKey | XPHBVJCROPBHNC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|