C11H10N4O4 — CID 104757841
1-(2,4-dimethyl-5-nitrophenyl)triazole-4-carboxylic acid (PubChem CID 104757841) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is 1-(2,4-dimethyl-5-nitrophenyl)triazole-4-carboxylic acid.
| Compound Name | 1-(2,4-dimethyl-5-nitrophenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 104757841 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 1-(2,4-dimethyl-5-nitrophenyl)triazole-4-carboxylic acid |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1-n1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C11H10N4O4/c1-6-3-7(2)10(15(18)19)4-9(6)14-5-8(11(16)17)12-13-14/h3-5H,1-2H3,(H,16,17) |
| InChIKey | GYWKRAXWVBJDAC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|