C15H19N3OS — CID 104761836
2-[(2-methoxy-2-methylpropyl)amino]quinoline-3-carbothioamide (PubChem CID 104761836) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-[(2-methoxy-2-methylpropyl)amino]quinoline-3-carbothioamide.
| Compound Name | 2-[(2-methoxy-2-methylpropyl)amino]quinoline-3-carbothioamide |
|---|---|
| PubChem CID | 104761836 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-[(2-methoxy-2-methylpropyl)amino]quinoline-3-carbothioamide |
| SMILES | COC(C)(C)CNc1nc2ccccc2cc1C(N)=S |
| InChI | InChI=1S/C15H19N3OS/c1-15(2,19-3)9-17-14-11(13(16)20)8-10-6-4-5-7-12(10)18-14/h4-8H,9H2,1-3H3,(H2,16,20)(H,17,18) |
| InChIKey | WUKZEATZQKRENW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|