C10H21N3O3 — CID 104762084
N'-hydroxy-4-[(3-methoxyoxolan-3-yl)methylamino]butanimidamide (PubChem CID 104762084) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is N'-hydroxy-4-[(3-methoxyoxolan-3-yl)methylamino]butanimidamide.
| Compound Name | N'-hydroxy-4-[(3-methoxyoxolan-3-yl)methylamino]butanimidamide |
|---|---|
| PubChem CID | 104762084 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N'-hydroxy-4-[(3-methoxyoxolan-3-yl)methylamino]butanimidamide |
| SMILES | COC1(CNCCCC(N)=NO)CCOC1 |
| InChI | InChI=1S/C10H21N3O3/c1-15-10(4-6-16-8-10)7-12-5-2-3-9(11)13-14/h12,14H,2-8H2,1H3,(H2,11,13) |
| InChIKey | RHGBQXSOTZEZOR-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|