C9H19N3O3 — CID 104762099
N'-hydroxy-2-[(3-methoxyoxolan-3-yl)methylamino]propanimidamide (PubChem CID 104762099) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is N'-hydroxy-2-[(3-methoxyoxolan-3-yl)methylamino]propanimidamide.
| Compound Name | N'-hydroxy-2-[(3-methoxyoxolan-3-yl)methylamino]propanimidamide |
|---|---|
| PubChem CID | 104762099 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | N'-hydroxy-2-[(3-methoxyoxolan-3-yl)methylamino]propanimidamide |
| SMILES | COC1(CNC(C)C(N)=NO)CCOC1 |
| InChI | InChI=1S/C9H19N3O3/c1-7(8(10)12-13)11-5-9(14-2)3-4-15-6-9/h7,11,13H,3-6H2,1-2H3,(H2,10,12) |
| InChIKey | IWYPPLSUXUSSNH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|