C11H23NO4 — CID 104759779
1,1-dimethoxy-N-[(3-methoxyoxolan-3-yl)methyl]propan-2-amine (PubChem CID 104759779) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1,1-dimethoxy-N-[(3-methoxyoxolan-3-yl)methyl]propan-2-amine.
| Compound Name | 1,1-dimethoxy-N-[(3-methoxyoxolan-3-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 104759779 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 1,1-dimethoxy-N-[(3-methoxyoxolan-3-yl)methyl]propan-2-amine |
| SMILES | COC(OC)C(C)NCC1(OC)CCOC1 |
| InChI | InChI=1S/C11H23NO4/c1-9(10(13-2)14-3)12-7-11(15-4)5-6-16-8-11/h9-10,12H,5-8H2,1-4H3 |
| InChIKey | RLMMAZICWQDUHX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|