C13H18N2O5S — CID 104764689
N-[(3-methoxyoxolan-3-yl)methyl]-4-sulfamoylbenzamide (PubChem CID 104764689) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is N-[(3-methoxyoxolan-3-yl)methyl]-4-sulfamoylbenzamide.
| Compound Name | N-[(3-methoxyoxolan-3-yl)methyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 104764689 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-[(3-methoxyoxolan-3-yl)methyl]-4-sulfamoylbenzamide |
| SMILES | COC1(CNC(=O)c2ccc(S(N)(=O)=O)cc2)CCOC1 |
| InChI | InChI=1S/C13H18N2O5S/c1-19-13(6-7-20-9-13)8-15-12(16)10-2-4-11(5-3-10)21(14,17)18/h2-5H,6-9H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | PTDBTZFKDHXJDK-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |