C11H14INO3S — CID 104708936
5-iodo-N-[(3-methoxyoxolan-3-yl)methyl]thiophene-3-carboxamide (PubChem CID 104708936) has the molecular formula C11H14INO3S and a molecular weight of 367.21 g/mol. Its IUPAC name is 5-iodo-N-[(3-methoxyoxolan-3-yl)methyl]thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-[(3-methoxyoxolan-3-yl)methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 104708936 |
| Molecular Formula | C11H14INO3S |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 5-iodo-N-[(3-methoxyoxolan-3-yl)methyl]thiophene-3-carboxamide |
| SMILES | COC1(CNC(=O)c2csc(I)c2)CCOC1 |
| InChI | InChI=1S/C11H14INO3S/c1-15-11(2-3-16-7-11)6-13-10(14)8-4-9(12)17-5-8/h4-5H,2-3,6-7H2,1H3,(H,13,14) |
| InChIKey | IHUWAYHWYAETLS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|