C10H14N2O3S — CID 104708938
N-[(3-methoxyoxolan-3-yl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 104708938) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is N-[(3-methoxyoxolan-3-yl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(3-methoxyoxolan-3-yl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 104708938 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | N-[(3-methoxyoxolan-3-yl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | COC1(CNC(=O)c2cscn2)CCOC1 |
| InChI | InChI=1S/C10H14N2O3S/c1-14-10(2-3-15-6-10)5-11-9(13)8-4-16-7-12-8/h4,7H,2-3,5-6H2,1H3,(H,11,13) |
| InChIKey | ZPYKIRHJHWTKJJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |