C12H17ClN2O3S — CID 104764327
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[(3-methoxyoxolan-3-yl)methyl]acetamide (PubChem CID 104764327) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[(3-methoxyoxolan-3-yl)methyl]acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[(3-methoxyoxolan-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 104764327 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-[(3-methoxyoxolan-3-yl)methyl]acetamide |
| SMILES | COC1(CNC(=O)Cc2nc(CCl)cs2)CCOC1 |
| InChI | InChI=1S/C12H17ClN2O3S/c1-17-12(2-3-18-8-12)7-14-10(16)4-11-15-9(5-13)6-19-11/h6H,2-5,7-8H2,1H3,(H,14,16) |
| InChIKey | UJPDKQMAFOSHRA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|