About 3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione
3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione (PubChem CID 104766524) has the molecular formula C15H26N2O4
and a molecular weight of 298.38 g/mol. Its IUPAC name is 3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione |
| PubChem CID | 104766524 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione |
| SMILES | CCC1(CC)NC(=O)C(C)N(CC2(OC)CCOC2)C1=O |
| InChI | InChI=1S/C15H26N2O4/c1-5-15(6-2)13(19)17(11(3)12(18)16-15)9-14(20-4)7-8-21-10-14/h11H,5-10H2,1-4H3,(H,16,18) |
| InChIKey | IGKJWHHUSGHAAK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione?
The IUPAC name of 3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione (CID 104766524) is 3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione.
What is the SMILES notation for 3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione?
The canonical SMILES for 3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione is CCC1(CC)NC(=O)C(C)N(CC2(OC)CCOC2)C1=O.
What is the InChIKey of 3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione?
The InChIKey is IGKJWHHUSGHAAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O4/c1-5-15(6-2)13(19)17(11(3)12(18)16-15)9-14(20-4)7-8-21-10-14/h11H,5-10H2,1-4H3,(H,16,18).
What are the key properties of 3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione?
3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione has a molecular weight of 298.38 g/mol, XLogP of 0.70, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethyl-1-[(3-methoxyoxolan-3-yl)methyl]-6-methylpiperazine-2,5-dione is sourced from PubChem (CID 104766524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).