C12H22N2O3 — CID 64884815
3,3-diethyl-1-(2-methoxyethyl)-6-methylpiperazine-2,5-dione (PubChem CID 64884815) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 3,3-diethyl-1-(2-methoxyethyl)-6-methylpiperazine-2,5-dione.
| Compound Name | 3,3-diethyl-1-(2-methoxyethyl)-6-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64884815 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 3,3-diethyl-1-(2-methoxyethyl)-6-methylpiperazine-2,5-dione |
| SMILES | CCC1(CC)NC(=O)C(C)N(CCOC)C1=O |
| InChI | InChI=1S/C12H22N2O3/c1-5-12(6-2)11(16)14(7-8-17-4)9(3)10(15)13-12/h9H,5-8H2,1-4H3,(H,13,15) |
| InChIKey | MXDADNHRVJUXNZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |