C11H20N2O3 — CID 64875371
1-(2-ethoxyethyl)-3,3,6-trimethylpiperazine-2,5-dione (PubChem CID 64875371) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3,3,6-trimethylpiperazine-2,5-dione.
| Compound Name | 1-(2-ethoxyethyl)-3,3,6-trimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64875371 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-(2-ethoxyethyl)-3,3,6-trimethylpiperazine-2,5-dione |
| SMILES | CCOCCN1C(=O)C(C)(C)NC(=O)C1C |
| InChI | InChI=1S/C11H20N2O3/c1-5-16-7-6-13-8(2)9(14)12-11(3,4)10(13)15/h8H,5-7H2,1-4H3,(H,12,14) |
| InChIKey | CDJMFWHWAJWUDC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|