C13H24N2O3 — CID 64959171
1-(3-ethoxypropyl)-6-ethyl-3,3-dimethylpiperazine-2,5-dione (PubChem CID 64959171) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-6-ethyl-3,3-dimethylpiperazine-2,5-dione.
| Compound Name | 1-(3-ethoxypropyl)-6-ethyl-3,3-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64959171 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-(3-ethoxypropyl)-6-ethyl-3,3-dimethylpiperazine-2,5-dione |
| SMILES | CCOCCCN1C(=O)C(C)(C)NC(=O)C1CC |
| InChI | InChI=1S/C13H24N2O3/c1-5-10-11(16)14-13(3,4)12(17)15(10)8-7-9-18-6-2/h10H,5-9H2,1-4H3,(H,14,16) |
| InChIKey | CNBKCSSNFMBHFJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|