C14H20N2O5 — CID 104767923
9-[(3-methoxyoxolan-3-yl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione (PubChem CID 104767923) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 9-[(3-methoxyoxolan-3-yl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 9-[(3-methoxyoxolan-3-yl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 104767923 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 9-[(3-methoxyoxolan-3-yl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione |
| SMILES | COC1(CN2C(=O)NC(=O)C3(CCCC3)C2=O)CCOC1 |
| InChI | InChI=1S/C14H20N2O5/c1-20-13(6-7-21-9-13)8-16-11(18)14(4-2-3-5-14)10(17)15-12(16)19/h2-9H2,1H3,(H,15,17,19) |
| InChIKey | ZXKKRLNCMFAFSL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|