2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid

C9H15NO4 — CID 104768155

IUPAC2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid
SMILESCOC1CC(NC(=O)C(=O)O)C1(C)C
InChIInChI=1S/C9H15NO4/c1-9(2)5(4-6(9)14-3)10-7(11)8(12)13/h5-6H,4H2,1-3H3,(H,10,11)(H,12,13)
InChIKeyGIYGRBCMPYTKMY-UHFFFAOYSA-N
MW201.22 g/mol
LogP0.00
Rot. Bonds2

About 2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid

2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid (PubChem CID 104768155) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid.

Molecular Properties

Compound Name2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid
PubChem CID104768155
Molecular FormulaC9H15NO4
Molecular Weight201.22 g/mol
Exact Mass201.10
IUPAC Name2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid
SMILESCOC1CC(NC(=O)C(=O)O)C1(C)C
InChIInChI=1S/C9H15NO4/c1-9(2)5(4-6(9)14-3)10-7(11)8(12)13/h5-6H,4H2,1-3H3,(H,10,11)(H,12,13)
InChIKeyGIYGRBCMPYTKMY-UHFFFAOYSA-N
XLogP0.00
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.22
LogP ≤ 50.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid?
The IUPAC name of 2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid (CID 104768155) is 2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid.
What is the SMILES notation for 2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid?
The canonical SMILES for 2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid is COC1CC(NC(=O)C(=O)O)C1(C)C.
What is the InChIKey of 2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid?
The InChIKey is GIYGRBCMPYTKMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4/c1-9(2)5(4-6(9)14-3)10-7(11)8(12)13/h5-6H,4H2,1-3H3,(H,10,11)(H,12,13).
What are the key properties of 2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid?
2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid has a molecular weight of 201.22 g/mol, XLogP of 0.00, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-methoxy-2,2-dimethylcyclobutyl)amino]-2-oxoacetic acid is sourced from PubChem (CID 104768155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).