C10H16ClNO2 — CID 130952253
2-chloro-N-(3-methoxy-2,2-dimethylcyclobutyl)prop-2-enamide (PubChem CID 130952253) has the molecular formula C10H16ClNO2 and a molecular weight of 217.70 g/mol. Its IUPAC name is 2-chloro-N-(3-methoxy-2,2-dimethylcyclobutyl)prop-2-enamide.
| Compound Name | 2-chloro-N-(3-methoxy-2,2-dimethylcyclobutyl)prop-2-enamide |
|---|---|
| PubChem CID | 130952253 |
| Molecular Formula | C10H16ClNO2 |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-chloro-N-(3-methoxy-2,2-dimethylcyclobutyl)prop-2-enamide |
| SMILES | C=C(Cl)C(=O)NC1CC(OC)C1(C)C |
| InChI | InChI=1S/C10H16ClNO2/c1-6(11)9(13)12-7-5-8(14-4)10(7,2)3/h7-8H,1,5H2,2-4H3,(H,12,13) |
| InChIKey | KFWAQPUTXZQBKN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|