C21H15N5OS2 — CID 10477074
2-(1H-indol-3-yl)-N-(5-quinolin-4-ylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 10477074) has the molecular formula C21H15N5OS2 and a molecular weight of 417.52 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-(5-quinolin-4-ylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(1H-indol-3-yl)-N-(5-quinolin-4-ylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 10477074 |
| Molecular Formula | C21H15N5OS2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-(5-quinolin-4-ylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)Nc1nnc(Sc2ccnc3ccccc23)s1 |
| InChI | InChI=1S/C21H15N5OS2/c27-19(11-13-12-23-16-7-3-1-5-14(13)16)24-20-25-26-21(29-20)28-18-9-10-22-17-8-4-2-6-15(17)18/h1-10,12,23H,11H2,(H,24,25,27) |
| InChIKey | ZCIIBGXPCLGLEK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|