C18H9ClF2N4OS2 — CID 10478086
N-[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]-2,6-difluorobenzamide (PubChem CID 10478086) has the molecular formula C18H9ClF2N4OS2 and a molecular weight of 434.88 g/mol. Its IUPAC name is N-[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 10478086 |
| Molecular Formula | C18H9ClF2N4OS2 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | N-[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]-2,6-difluorobenzamide |
| SMILES | O=C(Nc1nnc(Sc2ccnc3cc(Cl)ccc23)s1)c1c(F)cccc1F |
| InChI | InChI=1S/C18H9ClF2N4OS2/c19-9-4-5-10-13(8-9)22-7-6-14(10)27-18-25-24-17(28-18)23-16(26)15-11(20)2-1-3-12(15)21/h1-8H,(H,23,24,26) |
| InChIKey | UQFCJHXLEVIRHP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|