C17H15N5O2S2 — CID 142915658
(3S)-3,5-dimethyl-N-(5-quinolin-4-ylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,2-oxazole-4-carboxamide (PubChem CID 142915658) has the molecular formula C17H15N5O2S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is (3S)-3,5-dimethyl-N-(5-quinolin-4-ylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,2-oxazole-4-carboxamide.
| Compound Name | (3S)-3,5-dimethyl-N-(5-quinolin-4-ylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 142915658 |
| Molecular Formula | C17H15N5O2S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (3S)-3,5-dimethyl-N-(5-quinolin-4-ylsulfanyl-1,3,4-thiadiazol-2-yl)-2,3-dihydro-1,2-oxazole-4-carboxamide |
| SMILES | CC1=C(C(=O)Nc2nnc(Sc3ccnc4ccccc34)s2)[C@H](C)NO1 |
| InChI | InChI=1S/C17H15N5O2S2/c1-9-14(10(2)24-22-9)15(23)19-16-20-21-17(26-16)25-13-7-8-18-12-6-4-3-5-11(12)13/h3-9,22H,1-2H3,(H,19,20,23)/t9-/m0/s1 |
| InChIKey | RXJVGFNYIOKJEJ-VIFPVBQESA-N |
| XLogP | 3.37 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|