C15H11ClN4O3S2 — CID 10453266
ethyl 2-[[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetate (PubChem CID 10453266) has the molecular formula C15H11ClN4O3S2 and a molecular weight of 394.87 g/mol. Its IUPAC name is ethyl 2-[[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 10453266 |
| Molecular Formula | C15H11ClN4O3S2 |
| Molecular Weight | 394.87 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | ethyl 2-[[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1nnc(Sc2ccnc3cc(Cl)ccc23)s1 |
| InChI | InChI=1S/C15H11ClN4O3S2/c1-2-23-13(22)12(21)18-14-19-20-15(25-14)24-11-5-6-17-10-7-8(16)3-4-9(10)11/h3-7H,2H2,1H3,(H,18,19,21) |
| InChIKey | YNUSJSUYCLROOL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.87 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|