C21H16ClN7OS2 — CID 70829343
1-[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]-3-[(1-methylbenzimidazol-2-yl)methyl]urea (PubChem CID 70829343) has the molecular formula C21H16ClN7OS2 and a molecular weight of 481.99 g/mol. Its IUPAC name is 1-[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]-3-[(1-methylbenzimidazol-2-yl)methyl]urea.
| Compound Name | 1-[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]-3-[(1-methylbenzimidazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 70829343 |
| Molecular Formula | C21H16ClN7OS2 |
| Molecular Weight | 481.99 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | 1-[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]-3-[(1-methylbenzimidazol-2-yl)methyl]urea |
| SMILES | Cn1c(CNC(=O)Nc2nnc(Sc3ccnc4cc(Cl)ccc34)s2)nc2ccccc21 |
| InChI | InChI=1S/C21H16ClN7OS2/c1-29-16-5-3-2-4-14(16)25-18(29)11-24-19(30)26-20-27-28-21(32-20)31-17-8-9-23-15-10-12(22)6-7-13(15)17/h2-10H,11H2,1H3,(H2,24,26,27,30) |
| InChIKey | VTQBKRVOZIYYRK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.99 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|