C14H12ClN5S2 — CID 2727564
N'-[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 2727564) has the molecular formula C14H12ClN5S2 and a molecular weight of 349.87 g/mol. Its IUPAC name is N'-[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 2727564 |
| Molecular Formula | C14H12ClN5S2 |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | N'-[5-(7-chloroquinolin-4-yl)sulfanyl-1,3,4-thiadiazol-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1nnc(Sc2ccnc3cc(Cl)ccc23)s1 |
| InChI | InChI=1S/C14H12ClN5S2/c1-20(2)8-17-13-18-19-14(22-13)21-12-5-6-16-11-7-9(15)3-4-10(11)12/h3-8H,1-2H3 |
| InChIKey | MEKAIZUJCFWEIN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|