C16H17ClN2OS — CID 51063627
2-(7-chloroquinolin-4-yl)sulfanyl-N-(1-methylcyclobutyl)acetamide (PubChem CID 51063627) has the molecular formula C16H17ClN2OS and a molecular weight of 320.84 g/mol. Its IUPAC name is 2-(7-chloroquinolin-4-yl)sulfanyl-N-(1-methylcyclobutyl)acetamide.
| Compound Name | 2-(7-chloroquinolin-4-yl)sulfanyl-N-(1-methylcyclobutyl)acetamide |
|---|---|
| PubChem CID | 51063627 |
| Molecular Formula | C16H17ClN2OS |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-(7-chloroquinolin-4-yl)sulfanyl-N-(1-methylcyclobutyl)acetamide |
| SMILES | CC1(NC(=O)CSc2ccnc3cc(Cl)ccc23)CCC1 |
| InChI | InChI=1S/C16H17ClN2OS/c1-16(6-2-7-16)19-15(20)10-21-14-5-8-18-13-9-11(17)3-4-12(13)14/h3-5,8-9H,2,6-7,10H2,1H3,(H,19,20) |
| InChIKey | QXUKBCDVAIWPMX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |