C15H9N5OS3 — CID 10451870
N-(5-quinazolin-4-ylsulfanyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide (PubChem CID 10451870) has the molecular formula C15H9N5OS3 and a molecular weight of 371.47 g/mol. Its IUPAC name is N-(5-quinazolin-4-ylsulfanyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(5-quinazolin-4-ylsulfanyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 10451870 |
| Molecular Formula | C15H9N5OS3 |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | N-(5-quinazolin-4-ylsulfanyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1nnc(Sc2ncnc3ccccc23)s1)c1cccs1 |
| InChI | InChI=1S/C15H9N5OS3/c21-12(11-6-3-7-22-11)18-14-19-20-15(24-14)23-13-9-4-1-2-5-10(9)16-8-17-13/h1-8H,(H,18,19,21) |
| InChIKey | BEYOAUPYJKPGDD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|